C37H41N2O7P — CID 10842030
benzyl N-[(2S)-1-[[(2S)-1-bis(phenylmethoxy)phosphoryl-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 10842030) has the molecular formula C37H41N2O7P and a molecular weight of 656.72 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-bis(phenylmethoxy)phosphoryl-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-bis(phenylmethoxy)phosphoryl-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10842030 |
| Molecular Formula | C37H41N2O7P |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-bis(phenylmethoxy)phosphoryl-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H41N2O7P/c1-28(2)23-33(39-37(42)44-25-30-17-9-4-10-18-30)35(40)38-34(24-29-15-7-3-8-16-29)36(41)47(43,45-26-31-19-11-5-12-20-31)46-27-32-21-13-6-14-22-32/h3-22,28,33-34H,23-27H2,1-2H3,(H,38,40)(H,39,42)/t33-,34-/m0/s1 |
| InChIKey | ZGBNVMMUFLCHKX-HEVIKAOCSA-N |
| XLogP | 7.21 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|