C38H43N2O8P — CID 57322937
benzyl N-[(2S)-1-[[(2S)-4-bis(phenylmethoxy)phosphoryloxy-3-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 57322937) has the molecular formula C38H43N2O8P and a molecular weight of 686.74 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-4-bis(phenylmethoxy)phosphoryloxy-3-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-4-bis(phenylmethoxy)phosphoryloxy-3-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 57322937 |
| Molecular Formula | C38H43N2O8P |
| Molecular Weight | 686.74 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-4-bis(phenylmethoxy)phosphoryloxy-3-oxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H43N2O8P/c1-29(2)23-35(40-38(43)45-25-31-17-9-4-10-18-31)37(42)39-34(24-30-15-7-3-8-16-30)36(41)28-48-49(44,46-26-32-19-11-5-12-20-32)47-27-33-21-13-6-14-22-33/h3-22,29,34-35H,23-28H2,1-2H3,(H,39,42)(H,40,43)/t34-,35-/m0/s1 |
| InChIKey | NTZDJTRRIOEZFL-PXLJZGITSA-N |
| XLogP | 7.18 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|