C21H33N2O8P — CID 22873502
tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-phenyl-4-phosphonooxybutan-2-yl]amino]pentan-2-yl]carbamate (PubChem CID 22873502) has the molecular formula C21H33N2O8P and a molecular weight of 472.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-phenyl-4-phosphonooxybutan-2-yl]amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-phenyl-4-phosphonooxybutan-2-yl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 22873502 |
| Molecular Formula | C21H33N2O8P |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-phenyl-4-phosphonooxybutan-2-yl]amino]pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C21H33N2O8P/c1-14(2)11-17(23-20(26)31-21(3,4)5)19(25)22-16(12-15-9-7-6-8-10-15)18(24)13-30-32(27,28)29/h6-10,14,16-17H,11-13H2,1-5H3,(H,22,25)(H,23,26)(H2,27,28,29)/t16-,17-/m0/s1 |
| InChIKey | IGZCBHIPTPLDTH-IRXDYDNUSA-N |
| XLogP | 2.33 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|