C18H17N3O8 — CID 25135866
methyl (2R)-3-(3,4-dinitrophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 25135866) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is methyl (2R)-3-(3,4-dinitrophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2R)-3-(3,4-dinitrophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 25135866 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl (2R)-3-(3,4-dinitrophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H17N3O8/c1-28-17(22)14(19-18(23)29-11-12-5-3-2-4-6-12)9-13-7-8-15(20(24)25)16(10-13)21(26)27/h2-8,10,14H,9,11H2,1H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | YWGQJGVXHDZCQP-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|