C18H18INO5 — CID 10695066
methyl (2S)-3-(4-hydroxy-3-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10695066) has the molecular formula C18H18INO5 and a molecular weight of 455.25 g/mol. Its IUPAC name is methyl (2S)-3-(4-hydroxy-3-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(4-hydroxy-3-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10695066 |
| Molecular Formula | C18H18INO5 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | methyl (2S)-3-(4-hydroxy-3-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(I)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18INO5/c1-24-17(22)15(10-13-7-8-16(21)14(19)9-13)20-18(23)25-11-12-5-3-2-4-6-12/h2-9,15,21H,10-11H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | JBKNJSGPLVELSQ-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|