C19H21NO6 — CID 14562832
ethyl 3-(3,4-dihydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 14562832) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl 3-(3,4-dihydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 14562832 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl 3-(3,4-dihydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO6/c1-2-25-18(23)15(10-14-8-9-16(21)17(22)11-14)20-19(24)26-12-13-6-4-3-5-7-13/h3-9,11,15,21-22H,2,10,12H2,1H3,(H,20,24) |
| InChIKey | LRAPLWHNJKLUFE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|