C14H17NO5 — CID 58271503
ethyl 3-(3,4-dihydroxyphenyl)-2-(prop-2-enoylamino)propanoate (PubChem CID 58271503) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxyphenyl)-2-(prop-2-enoylamino)propanoate.
| Compound Name | ethyl 3-(3,4-dihydroxyphenyl)-2-(prop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 58271503 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 3-(3,4-dihydroxyphenyl)-2-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)NC(Cc1ccc(O)c(O)c1)C(=O)OCC |
| InChI | InChI=1S/C14H17NO5/c1-3-13(18)15-10(14(19)20-4-2)7-9-5-6-11(16)12(17)8-9/h3,5-6,8,10,16-17H,1,4,7H2,2H3,(H,15,18) |
| InChIKey | ZYUKGIDLOKDYFA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|