C19H25NO7 — CID 58271494
4-prop-2-enoyloxybutyl 3-(3,4-dihydroxyphenyl)-2-(propanoylamino)propanoate (PubChem CID 58271494) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 3-(3,4-dihydroxyphenyl)-2-(propanoylamino)propanoate.
| Compound Name | 4-prop-2-enoyloxybutyl 3-(3,4-dihydroxyphenyl)-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 58271494 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 3-(3,4-dihydroxyphenyl)-2-(propanoylamino)propanoate |
| SMILES | C=CC(=O)OCCCCOC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)CC |
| InChI | InChI=1S/C19H25NO7/c1-3-17(23)20-14(11-13-7-8-15(21)16(22)12-13)19(25)27-10-6-5-9-26-18(24)4-2/h4,7-8,12,14,21-22H,2-3,5-6,9-11H2,1H3,(H,20,23) |
| InChIKey | HINWDXYTBCSUQG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|