C13H20ClNO4 — CID 44814688
butyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride (PubChem CID 44814688) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is butyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride.
| Compound Name | butyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 44814688 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | butyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
| SMILES | CCCCOC(=O)[C@@H](N)Cc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-2-3-6-18-13(17)10(14)7-9-4-5-11(15)12(16)8-9;/h4-5,8,10,15-16H,2-3,6-7,14H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | QTEPFWVKPWPEQT-PPHPATTJSA-N |
| XLogP | 1.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|