C18H28N2O5 — CID 70251915
[5-[(2S)-2-amino-3-butoxy-3-oxopropyl]-2-hydroxyphenyl] 4-aminopentanoate (PubChem CID 70251915) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is [5-[(2S)-2-amino-3-butoxy-3-oxopropyl]-2-hydroxyphenyl] 4-aminopentanoate.
| Compound Name | [5-[(2S)-2-amino-3-butoxy-3-oxopropyl]-2-hydroxyphenyl] 4-aminopentanoate |
|---|---|
| PubChem CID | 70251915 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [5-[(2S)-2-amino-3-butoxy-3-oxopropyl]-2-hydroxyphenyl] 4-aminopentanoate |
| SMILES | CCCCOC(=O)[C@@H](N)Cc1ccc(O)c(OC(=O)CCC(C)N)c1 |
| InChI | InChI=1S/C18H28N2O5/c1-3-4-9-24-18(23)14(20)10-13-6-7-15(21)16(11-13)25-17(22)8-5-12(2)19/h6-7,11-12,14,21H,3-5,8-10,19-20H2,1-2H3/t12?,14-/m0/s1 |
| InChIKey | LXWIWXKTLGSNPN-PYMCNQPYSA-N |
| XLogP | 1.64 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|