C17H27NO4 — CID 166028486
butyl (2S)-2-amino-3-(3-butoxy-4-hydroxyphenyl)propanoate (PubChem CID 166028486) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is butyl (2S)-2-amino-3-(3-butoxy-4-hydroxyphenyl)propanoate.
| Compound Name | butyl (2S)-2-amino-3-(3-butoxy-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 166028486 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | butyl (2S)-2-amino-3-(3-butoxy-4-hydroxyphenyl)propanoate |
| SMILES | CCCCOC(=O)[C@@H](N)Cc1ccc(O)c(OCCCC)c1 |
| InChI | InChI=1S/C17H27NO4/c1-3-5-9-21-16-12-13(7-8-15(16)19)11-14(18)17(20)22-10-6-4-2/h7-8,12,14,19H,3-6,9-11,18H2,1-2H3/t14-/m0/s1 |
| InChIKey | NJISQFCNOULFEW-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|