C14H21NO5 — CID 63684327
2-propoxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 63684327) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-propoxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | 2-propoxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 63684327 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-propoxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | CCCOCCOC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H21NO5/c1-2-5-19-6-7-20-14(18)11(15)8-10-3-4-12(16)13(17)9-10/h3-4,9,11,16-17H,2,5-8,15H2,1H3/t11-/m0/s1 |
| InChIKey | JCKSUWRCKBBARV-NSHDSACASA-N |
| XLogP | 0.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|