C13H18ClNO6 — CID 57462281
2-acetyloxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride (PubChem CID 57462281) has the molecular formula C13H18ClNO6 and a molecular weight of 319.74 g/mol. Its IUPAC name is 2-acetyloxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride.
| Compound Name | 2-acetyloxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 57462281 |
| Molecular Formula | C13H18ClNO6 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-acetyloxyethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate;hydrochloride |
| SMILES | CC(=O)OCCOC(=O)[C@@H](N)Cc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C13H17NO6.ClH/c1-8(15)19-4-5-20-13(18)10(14)6-9-2-3-11(16)12(17)7-9;/h2-3,7,10,16-17H,4-6,14H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | RIKPNCDXXVKNCW-PPHPATTJSA-N |
| XLogP | 0.50 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|