C10H11F2NO4 — CID 77228618
difluoromethyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 77228618) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is difluoromethyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | difluoromethyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 77228618 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | difluoromethyl 2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)OC(F)F |
| InChI | InChI=1S/C10H11F2NO4/c11-10(12)17-9(16)6(13)3-5-1-2-7(14)8(15)4-5/h1-2,4,6,10,14-15H,3,13H2 |
| InChIKey | KBMYRUMKPAIMRY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|