C9H13NO5 — CID 77239806
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;hydrate (PubChem CID 77239806) has the molecular formula C9H13NO5 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;hydrate.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 77239806 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;hydrate |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)O.O |
| InChI | InChI=1S/C9H11NO4.H2O/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;/h1-2,4,6,11-12H,3,10H2,(H,13,14);1H2 |
| InChIKey | QVCHZTRPNOGALK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|