C12H19NO7 — CID 174893743
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;propane-1,2,3-triol (PubChem CID 174893743) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;propane-1,2,3-triol.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174893743 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;propane-1,2,3-triol |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)O.OCC(O)CO |
| InChI | InChI=1S/C9H11NO4.C3H8O3/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;4-1-3(6)2-5/h1-2,4,6,11-12H,3,10H2,(H,13,14);3-6H,1-2H2 |
| InChIKey | LVVKVRMDVYNXHK-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|