C12H18N2O9S — CID 175207309
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-amino-3-sulfopropanoic acid (PubChem CID 175207309) has the molecular formula C12H18N2O9S and a molecular weight of 366.35 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-amino-3-sulfopropanoic acid.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-amino-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 175207309 |
| Molecular Formula | C12H18N2O9S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-amino-3-sulfopropanoic acid |
| SMILES | NC(CS(=O)(=O)O)C(=O)O.NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4.C3H7NO5S/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;4-2(3(5)6)1-10(7,8)9/h1-2,4,6,11-12H,3,10H2,(H,13,14);2H,1,4H2,(H,5,6)(H,7,8,9) |
| InChIKey | YMXZCQLXUDJBLM-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 221.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|