C12H17NO8S2 — CID 54431451
(2S)-2-amino-3-[4-(1,3-disulfopropan-2-yl)phenyl]propanoic acid (PubChem CID 54431451) has the molecular formula C12H17NO8S2 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(1,3-disulfopropan-2-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(1,3-disulfopropan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54431451 |
| Molecular Formula | C12H17NO8S2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2S)-2-amino-3-[4-(1,3-disulfopropan-2-yl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(C(CS(=O)(=O)O)CS(=O)(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C12H17NO8S2/c13-11(12(14)15)5-8-1-3-9(4-2-8)10(6-22(16,17)18)7-23(19,20)21/h1-4,10-11H,5-7,13H2,(H,14,15)(H,16,17,18)(H,19,20,21)/t11-/m0/s1 |
| InChIKey | WHTLHJDTBYXNGM-NSHDSACASA-N |
| XLogP | -0.50 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|