C11H13NO5S — CID 46185415
2-amino-3-[4-(1-sulfoethenyl)phenyl]propanoic acid (PubChem CID 46185415) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-amino-3-[4-(1-sulfoethenyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(1-sulfoethenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 46185415 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-amino-3-[4-(1-sulfoethenyl)phenyl]propanoic acid |
| SMILES | C=C(c1ccc(CC(N)C(=O)O)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C11H13NO5S/c1-7(18(15,16)17)9-4-2-8(3-5-9)6-10(12)11(13)14/h2-5,10H,1,6,12H2,(H,13,14)(H,15,16,17) |
| InChIKey | NEESHKKRXOSOQD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|