C9H14FNO7S — CID 175411627
2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfuric acid;hydrofluoride (PubChem CID 175411627) has the molecular formula C9H14FNO7S and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfuric acid;hydrofluoride.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfuric acid;hydrofluoride |
|---|---|
| PubChem CID | 175411627 |
| Molecular Formula | C9H14FNO7S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;sulfuric acid;hydrofluoride |
| SMILES | F.NC(Cc1ccc(O)cc1)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H11NO3.FH.H2O4S/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;;1-5(2,3)4/h1-4,8,11H,5,10H2,(H,12,13);1H;(H2,1,2,3,4) |
| InChIKey | JPVQAPCWKLXTJL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|