C10H13BrNO5P — CID 52947425
(2S)-2-amino-3-[4-[bromo(phosphono)methyl]phenyl]propanoic acid (PubChem CID 52947425) has the molecular formula C10H13BrNO5P and a molecular weight of 338.09 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[bromo(phosphono)methyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[bromo(phosphono)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 52947425 |
| Molecular Formula | C10H13BrNO5P |
| Molecular Weight | 338.09 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | (2S)-2-amino-3-[4-[bromo(phosphono)methyl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(C(Br)P(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13BrNO5P/c11-9(18(15,16)17)7-3-1-6(2-4-7)5-8(12)10(13)14/h1-4,8-9H,5,12H2,(H,13,14)(H2,15,16,17)/t8-,9?/m0/s1 |
| InChIKey | BIIORFATBBJOTO-IENPIDJESA-N |
| XLogP | 1.21 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.09 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|