C11H16NO5P — CID 54162396
(2S)-2-amino-3-[4-(2-phosphonoethyl)phenyl]propanoic acid (PubChem CID 54162396) has the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(2-phosphonoethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(2-phosphonoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54162396 |
| Molecular Formula | C11H16NO5P |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2S)-2-amino-3-[4-(2-phosphonoethyl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(CCP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C11H16NO5P/c12-10(11(13)14)7-9-3-1-8(2-4-9)5-6-18(15,16)17/h1-4,10H,5-7,12H2,(H,13,14)(H2,15,16,17)/t10-/m0/s1 |
| InChIKey | OPIKGOYTTHFGBY-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|