C11H16BNO4 — CID 170790960
(2S)-2-amino-3-[4-(2-boronoethyl)phenyl]propanoic acid (PubChem CID 170790960) has the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(2-boronoethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(2-boronoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170790960 |
| Molecular Formula | C11H16BNO4 |
| Molecular Weight | 237.06 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (2S)-2-amino-3-[4-(2-boronoethyl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(CCB(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C11H16BNO4/c13-10(11(14)15)7-9-3-1-8(2-4-9)5-6-12(16)17/h1-4,10,16-17H,5-7,13H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | APSZRMZUNIQVFK-JTQLQIEISA-N |
| XLogP | -0.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.06 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|