C10H15ClNO5P — CID 14102034
2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid;hydrochloride (PubChem CID 14102034) has the molecular formula C10H15ClNO5P and a molecular weight of 295.66 g/mol. Its IUPAC name is 2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 14102034 |
| Molecular Formula | C10H15ClNO5P |
| Molecular Weight | 295.66 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-amino-3-[4-(phosphonomethyl)phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.NC(Cc1ccc(CP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C10H14NO5P.ClH/c11-9(10(12)13)5-7-1-3-8(4-2-7)6-17(14,15)16;/h1-4,9H,5-6,11H2,(H,12,13)(H2,14,15,16);1H |
| InChIKey | RCMIDZVUQQDLML-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|