C11H14ClNO4 — CID 73014170
2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride (PubChem CID 73014170) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 73014170 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.NC(Cc1ccc(CC(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4.ClH/c12-9(11(15)16)5-7-1-3-8(4-2-7)6-10(13)14;/h1-4,9H,5-6,12H2,(H,13,14)(H,15,16);1H |
| InChIKey | UHQUHPFJRUJHRH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |