C9H14NO6P — CID 69256831
(2S)-2-amino-3-phenylpropanoic acid;phosphoric acid (PubChem CID 69256831) has the molecular formula C9H14NO6P and a molecular weight of 263.19 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;phosphoric acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 69256831 |
| Molecular Formula | C9H14NO6P |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;phosphoric acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C9H11NO2.H3O4P/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-5(2,3)4/h1-5,8H,6,10H2,(H,11,12);(H3,1,2,3,4)/t8-;/m0./s1 |
| InChIKey | LENNZWPGZUQFEU-QRPNPIFTSA-N |
| XLogP | -0.29 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|