About acetylene;(2S)-2-amino-3-phenylpropanoic acid
acetylene;(2S)-2-amino-3-phenylpropanoic acid (PubChem CID 158164827) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is acetylene;(2S)-2-amino-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | acetylene;(2S)-2-amino-3-phenylpropanoic acid |
| PubChem CID | 158164827 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | acetylene;(2S)-2-amino-3-phenylpropanoic acid |
| SMILES | C#C.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C2H2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-2/h1-5,8H,6,10H2,(H,11,12);1-2H/t8-;/m0./s1 |
| InChIKey | FWSDAVYYSJQGNI-QRPNPIFTSA-N |
| XLogP | 0.89 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(2S)-2-amino-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(2S)-2-amino-3-phenylpropanoic acid?
The IUPAC name of acetylene;(2S)-2-amino-3-phenylpropanoic acid (CID 158164827) is acetylene;(2S)-2-amino-3-phenylpropanoic acid.
What is the SMILES notation for acetylene;(2S)-2-amino-3-phenylpropanoic acid?
The canonical SMILES for acetylene;(2S)-2-amino-3-phenylpropanoic acid is C#C.N[C@@H](Cc1ccccc1)C(=O)O.
What is the InChIKey of acetylene;(2S)-2-amino-3-phenylpropanoic acid?
The InChIKey is FWSDAVYYSJQGNI-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H11NO2.C2H2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-2/h1-5,8H,6,10H2,(H,11,12);1-2H/t8-;/m0./s1.
What are the key properties of acetylene;(2S)-2-amino-3-phenylpropanoic acid?
acetylene;(2S)-2-amino-3-phenylpropanoic acid has a molecular weight of 191.23 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(2S)-2-amino-3-phenylpropanoic acid is sourced from PubChem (CID 158164827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).