About (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane
(2S)-2-amino-3-phenylpropanoic acid;λ2-stannane (PubChem CID 175107963) has the molecular formula C9H13NO2Sn
and a molecular weight of 285.92 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane.
Molecular Properties
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane |
| PubChem CID | 175107963 |
| Molecular Formula | C9H13NO2Sn |
| Molecular Weight | 285.92 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.[SnH2] |
| InChI | InChI=1S/C9H11NO2.Sn.2H/c10-8(9(11)12)6-7-4-2-1-3-5-7;;;/h1-5,8H,6,10H2,(H,11,12);;;/t8-;;;/m0.../s1 |
| InChIKey | GRSMZAHAGSPOAU-CZDIJEQGSA-N |
| XLogP | -0.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.92 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane?
The IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane (CID 175107963) is (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane.
What is the SMILES notation for (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane?
The canonical SMILES for (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane is N[C@@H](Cc1ccccc1)C(=O)O.[SnH2].
What is the InChIKey of (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane?
The InChIKey is GRSMZAHAGSPOAU-CZDIJEQGSA-N. The full InChI is InChI=1S/C9H11NO2.Sn.2H/c10-8(9(11)12)6-7-4-2-1-3-5-7;;;/h1-5,8H,6,10H2,(H,11,12);;;/t8-;;;/m0.../s1.
What are the key properties of (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane?
(2S)-2-amino-3-phenylpropanoic acid;λ2-stannane has a molecular weight of 285.92 g/mol, XLogP of -0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-phenylpropanoic acid;λ2-stannane is sourced from PubChem (CID 175107963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).