C9H15NO6P2 — CID 174881323
2-amino-3-(4-phosphonooxyphenyl)propanoic acid;phosphane (PubChem CID 174881323) has the molecular formula C9H15NO6P2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-amino-3-(4-phosphonooxyphenyl)propanoic acid;phosphane.
| Compound Name | 2-amino-3-(4-phosphonooxyphenyl)propanoic acid;phosphane |
|---|---|
| PubChem CID | 174881323 |
| Molecular Formula | C9H15NO6P2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-amino-3-(4-phosphonooxyphenyl)propanoic acid;phosphane |
| SMILES | NC(Cc1ccc(OP(=O)(O)O)cc1)C(=O)O.P |
| InChI | InChI=1S/C9H12NO6P.H3P/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15;/h1-4,8H,5,10H2,(H,11,12)(H2,13,14,15);1H3 |
| InChIKey | CWGHDUHQHXJZCT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|