C10H14NO5P — CID 58672481
[4-(3-amino-2-methyl-3-oxopropyl)phenyl] dihydrogen phosphate (PubChem CID 58672481) has the molecular formula C10H14NO5P and a molecular weight of 259.20 g/mol. Its IUPAC name is [4-(3-amino-2-methyl-3-oxopropyl)phenyl] dihydrogen phosphate.
| Compound Name | [4-(3-amino-2-methyl-3-oxopropyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58672481 |
| Molecular Formula | C10H14NO5P |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [4-(3-amino-2-methyl-3-oxopropyl)phenyl] dihydrogen phosphate |
| SMILES | CC(Cc1ccc(OP(=O)(O)O)cc1)C(N)=O |
| InChI | InChI=1S/C10H14NO5P/c1-7(10(11)12)6-8-2-4-9(5-3-8)16-17(13,14)15/h2-5,7H,6H2,1H3,(H2,11,12)(H2,13,14,15) |
| InChIKey | UNEDNBHRJSEXMS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|