About (4-but-2-enylphenyl) dihydrogen phosphate
(4-but-2-enylphenyl) dihydrogen phosphate (PubChem CID 154126287) has the molecular formula C10H13O4P
and a molecular weight of 228.18 g/mol. Its IUPAC name is (4-but-2-enylphenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | (4-but-2-enylphenyl) dihydrogen phosphate |
| PubChem CID | 154126287 |
| Molecular Formula | C10H13O4P |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (4-but-2-enylphenyl) dihydrogen phosphate |
| SMILES | CC=CCc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C10H13O4P/c1-2-3-4-9-5-7-10(8-6-9)14-15(11,12)13/h2-3,5-8H,4H2,1H3,(H2,11,12,13) |
| InChIKey | DYZTWZPITCRCGU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-but-2-enylphenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-but-2-enylphenyl) dihydrogen phosphate?
The IUPAC name of (4-but-2-enylphenyl) dihydrogen phosphate (CID 154126287) is (4-but-2-enylphenyl) dihydrogen phosphate.
What is the SMILES notation for (4-but-2-enylphenyl) dihydrogen phosphate?
The canonical SMILES for (4-but-2-enylphenyl) dihydrogen phosphate is CC=CCc1ccc(OP(=O)(O)O)cc1.
What is the InChIKey of (4-but-2-enylphenyl) dihydrogen phosphate?
The InChIKey is DYZTWZPITCRCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O4P/c1-2-3-4-9-5-7-10(8-6-9)14-15(11,12)13/h2-3,5-8H,4H2,1H3,(H2,11,12,13).
What are the key properties of (4-but-2-enylphenyl) dihydrogen phosphate?
(4-but-2-enylphenyl) dihydrogen phosphate has a molecular weight of 228.18 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-but-2-enylphenyl) dihydrogen phosphate is sourced from PubChem (CID 154126287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).