C12H15O6P — CID 174408974
[4-(2-hydroxy-2-methyl-3-oxopent-4-enyl)phenyl] dihydrogen phosphate (PubChem CID 174408974) has the molecular formula C12H15O6P and a molecular weight of 286.22 g/mol. Its IUPAC name is [4-(2-hydroxy-2-methyl-3-oxopent-4-enyl)phenyl] dihydrogen phosphate.
| Compound Name | [4-(2-hydroxy-2-methyl-3-oxopent-4-enyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174408974 |
| Molecular Formula | C12H15O6P |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | [4-(2-hydroxy-2-methyl-3-oxopent-4-enyl)phenyl] dihydrogen phosphate |
| SMILES | C=CC(=O)C(C)(O)Cc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C12H15O6P/c1-3-11(13)12(2,14)8-9-4-6-10(7-5-9)18-19(15,16)17/h3-7,14H,1,8H2,2H3,(H2,15,16,17) |
| InChIKey | QXYRUDURVVBXOR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|