C13H18O2 — CID 79189896
1-(4-methoxyphenyl)-2,3-dimethylbut-3-en-2-ol (PubChem CID 79189896) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,3-dimethylbut-3-en-2-ol.
| Compound Name | 1-(4-methoxyphenyl)-2,3-dimethylbut-3-en-2-ol |
|---|---|
| PubChem CID | 79189896 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,3-dimethylbut-3-en-2-ol |
| SMILES | C=C(C)C(C)(O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H18O2/c1-10(2)13(3,14)9-11-5-7-12(15-4)8-6-11/h5-8,14H,1,9H2,2-4H3 |
| InChIKey | RZNWZXDGKVSNCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|