C21H28ClNO3 — CID 163512898
3-[(dimethylamino)methyl]-1,2-bis(4-methoxyphenyl)but-3-en-2-ol;hydrochloride (PubChem CID 163512898) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-1,2-bis(4-methoxyphenyl)but-3-en-2-ol;hydrochloride.
| Compound Name | 3-[(dimethylamino)methyl]-1,2-bis(4-methoxyphenyl)but-3-en-2-ol;hydrochloride |
|---|---|
| PubChem CID | 163512898 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-[(dimethylamino)methyl]-1,2-bis(4-methoxyphenyl)but-3-en-2-ol;hydrochloride |
| SMILES | C=C(CN(C)C)C(O)(Cc1ccc(OC)cc1)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C21H27NO3.ClH/c1-16(15-22(2)3)21(23,18-8-12-20(25-5)13-9-18)14-17-6-10-19(24-4)11-7-17;/h6-13,23H,1,14-15H2,2-5H3;1H |
| InChIKey | DEEPSEKAUPPTCG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|