C18H19NO2 — CID 129389679
(2R)-2,3-bis(4-methoxyphenyl)-2-methylpropanenitrile (PubChem CID 129389679) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2R)-2,3-bis(4-methoxyphenyl)-2-methylpropanenitrile.
| Compound Name | (2R)-2,3-bis(4-methoxyphenyl)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 129389679 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2R)-2,3-bis(4-methoxyphenyl)-2-methylpropanenitrile |
| SMILES | COc1ccc(C[C@@](C)(C#N)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-18(13-19,15-6-10-17(21-3)11-7-15)12-14-4-8-16(20-2)9-5-14/h4-11H,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | ZNLSTQOVERFACG-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |