C15H16O2 — CID 139260557
4-(4-methoxyphenyl)-3-methylhepta-1,2-dien-6-yn-4-ol (PubChem CID 139260557) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-methylhepta-1,2-dien-6-yn-4-ol.
| Compound Name | 4-(4-methoxyphenyl)-3-methylhepta-1,2-dien-6-yn-4-ol |
|---|---|
| PubChem CID | 139260557 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-methylhepta-1,2-dien-6-yn-4-ol |
| SMILES | C#CCC(O)(C(C)=C=C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H16O2/c1-5-11-15(16,12(3)6-2)13-7-9-14(17-4)10-8-13/h1,7-10,16H,2,11H2,3-4H3 |
| InChIKey | OEOIOHFYLLNAEO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|