C27H24O3 — CID 70611668
1-(4-methoxyphenyl)-1,2,2-triphenylethane-1,2-diol (PubChem CID 70611668) has the molecular formula C27H24O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1,2,2-triphenylethane-1,2-diol.
| Compound Name | 1-(4-methoxyphenyl)-1,2,2-triphenylethane-1,2-diol |
|---|---|
| PubChem CID | 70611668 |
| Molecular Formula | C27H24O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-1,2,2-triphenylethane-1,2-diol |
| SMILES | COc1ccc(C(O)(c2ccccc2)C(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24O3/c1-30-25-19-17-24(18-20-25)27(29,23-15-9-4-10-16-23)26(28,21-11-5-2-6-12-21)22-13-7-3-8-14-22/h2-20,28-29H,1H3 |
| InChIKey | WHFXDVSOFPEIIX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |