C22H17F5O2 — CID 166059803
2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-(3-phenylphenyl)propan-1-ol (PubChem CID 166059803) has the molecular formula C22H17F5O2 and a molecular weight of 408.37 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-(3-phenylphenyl)propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-(3-phenylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 166059803 |
| Molecular Formula | C22H17F5O2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-(3-phenylphenyl)propan-1-ol |
| SMILES | COc1ccc(C(O)(c2cccc(-c3ccccc3)c2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F5O2/c1-29-19-12-10-17(11-13-19)20(28,21(23,24)22(25,26)27)18-9-5-8-16(14-18)15-6-3-2-4-7-15/h2-14,28H,1H3 |
| InChIKey | UMYBJPXHFWDQQC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|