C16H12BrF5O2 — CID 162511470
1-(3-bromophenyl)-2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)propan-1-ol (PubChem CID 162511470) has the molecular formula C16H12BrF5O2 and a molecular weight of 411.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(3-bromophenyl)-2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 162511470 |
| Molecular Formula | C16H12BrF5O2 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 1-(3-bromophenyl)-2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)propan-1-ol |
| SMILES | COc1cccc(C(O)(c2cccc(Br)c2)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12BrF5O2/c1-24-13-7-3-5-11(9-13)14(23,15(18,19)16(20,21)22)10-4-2-6-12(17)8-10/h2-9,23H,1H3 |
| InChIKey | LMYZXDKFBZFOTD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|