C17H12F8O2 — CID 162511487
2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 162511487) has the molecular formula C17H12F8O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 162511487 |
| Molecular Formula | C17H12F8O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | COc1cccc(C(O)(c2ccc(C(F)(F)F)cc2)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F8O2/c1-27-13-4-2-3-12(9-13)14(26,16(21,22)17(23,24)25)10-5-7-11(8-6-10)15(18,19)20/h2-9,26H,1H3 |
| InChIKey | JDGGQEOSCOMHPH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|