C16H10F8O — CID 162511318
2,2,3,3,3-pentafluoro-1-phenyl-1-[4-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 162511318) has the molecular formula C16H10F8O and a molecular weight of 370.24 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-phenyl-1-[4-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-phenyl-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 162511318 |
| Molecular Formula | C16H10F8O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-phenyl-1-[4-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | OC(c1ccccc1)(c1ccc(C(F)(F)F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F8O/c17-14(18,19)12-8-6-11(7-9-12)13(25,10-4-2-1-3-5-10)15(20,21)16(22,23)24/h1-9,25H |
| InChIKey | RPGYHNUBFRUSTM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|