C15H12F5NO — CID 162511631
2,2,3,3,3-pentafluoro-1-(4-methylphenyl)-1-pyridin-3-ylpropan-1-ol (PubChem CID 162511631) has the molecular formula C15H12F5NO and a molecular weight of 317.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-methylphenyl)-1-pyridin-3-ylpropan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-methylphenyl)-1-pyridin-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511631 |
| Molecular Formula | C15H12F5NO |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-methylphenyl)-1-pyridin-3-ylpropan-1-ol |
| SMILES | Cc1ccc(C(O)(c2cccnc2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F5NO/c1-10-4-6-11(7-5-10)13(22,12-3-2-8-21-9-12)14(16,17)15(18,19)20/h2-9,22H,1H3 |
| InChIKey | APIBLSDYBQFTSF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|