About lithium;3-(trifluoromethyl)pyridine;hydroxide
lithium;3-(trifluoromethyl)pyridine;hydroxide (PubChem CID 175395480) has the molecular formula C6H5F3LiNO
and a molecular weight of 171.05 g/mol. Its IUPAC name is lithium;3-(trifluoromethyl)pyridine;hydroxide.
Molecular Properties
| Compound Name | lithium;3-(trifluoromethyl)pyridine;hydroxide |
| PubChem CID | 175395480 |
| Molecular Formula | C6H5F3LiNO |
| Molecular Weight | 171.05 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | lithium;3-(trifluoromethyl)pyridine;hydroxide |
| SMILES | FC(F)(F)c1cccnc1.[Li+].[OH-] |
| InChI | InChI=1S/C6H4F3N.Li.H2O/c7-6(8,9)5-2-1-3-10-4-5;;/h1-4H;;1H2/q;+1;/p-1 |
| InChIKey | BYRYBFIRSJYXKA-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 42.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.05 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium;3-(trifluoromethyl)pyridine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;3-(trifluoromethyl)pyridine;hydroxide?
The IUPAC name of lithium;3-(trifluoromethyl)pyridine;hydroxide (CID 175395480) is lithium;3-(trifluoromethyl)pyridine;hydroxide.
What is the SMILES notation for lithium;3-(trifluoromethyl)pyridine;hydroxide?
The canonical SMILES for lithium;3-(trifluoromethyl)pyridine;hydroxide is FC(F)(F)c1cccnc1.[Li+].[OH-].
What is the InChIKey of lithium;3-(trifluoromethyl)pyridine;hydroxide?
The InChIKey is BYRYBFIRSJYXKA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4F3N.Li.H2O/c7-6(8,9)5-2-1-3-10-4-5;;/h1-4H;;1H2/q;+1;/p-1.
What are the key properties of lithium;3-(trifluoromethyl)pyridine;hydroxide?
lithium;3-(trifluoromethyl)pyridine;hydroxide has a molecular weight of 171.05 g/mol, XLogP of -1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;3-(trifluoromethyl)pyridine;hydroxide is sourced from PubChem (CID 175395480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).