C13H7F6N — CID 46315288
3-[3,5-bis(trifluoromethyl)phenyl]pyridine (PubChem CID 46315288) has the molecular formula C13H7F6N and a molecular weight of 291.19 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]pyridine.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 46315288 |
| Molecular Formula | C13H7F6N |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1cc(-c2cccnc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F6N/c14-12(15,16)10-4-9(8-2-1-3-20-7-8)5-11(6-10)13(17,18)19/h1-7H |
| InChIKey | WEHGPXOSSNRHSN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |