C44H32N4 — CID 158338475
benzene;3-[3-[3-(3,5-dipyridin-3-ylphenyl)phenyl]-5-pyridin-3-ylphenyl]pyridine (PubChem CID 158338475) has the molecular formula C44H32N4 and a molecular weight of 616.77 g/mol. Its IUPAC name is benzene;3-[3-[3-(3,5-dipyridin-3-ylphenyl)phenyl]-5-pyridin-3-ylphenyl]pyridine.
| Compound Name | benzene;3-[3-[3-(3,5-dipyridin-3-ylphenyl)phenyl]-5-pyridin-3-ylphenyl]pyridine |
|---|---|
| PubChem CID | 158338475 |
| Molecular Formula | C44H32N4 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | benzene;3-[3-[3-(3,5-dipyridin-3-ylphenyl)phenyl]-5-pyridin-3-ylphenyl]pyridine |
| SMILES | c1ccccc1.c1cncc(-c2cc(-c3cccnc3)cc(-c3cccc(-c4cc(-c5cccnc5)cc(-c5cccnc5)c4)c3)c2)c1 |
| InChI | InChI=1S/C38H26N4.C6H6/c1-6-27(33-17-35(29-8-2-12-39-23-29)21-36(18-33)30-9-3-13-40-24-30)16-28(7-1)34-19-37(31-10-4-14-41-25-31)22-38(20-34)32-11-5-15-42-26-32;1-2-4-6-5-3-1/h1-26H;1-6H |
| InChIKey | GQWKRHVINIPVLF-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |