C42H35N3 — CID 144612655
3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine;propane (PubChem CID 144612655) has the molecular formula C42H35N3 and a molecular weight of 581.76 g/mol. Its IUPAC name is 3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine;propane.
| Compound Name | 3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine;propane |
|---|---|
| PubChem CID | 144612655 |
| Molecular Formula | C42H35N3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine;propane |
| SMILES | CCC.c1cncc(-c2cccc(-c3cc(-c4cccc(-c5cccnc5)c4)cc(-c4cccc(-c5cccnc5)c4)c3)c2)c1 |
| InChI | InChI=1S/C39H27N3.C3H8/c1-7-28(34-13-4-16-40-25-34)19-31(10-1)37-22-38(32-11-2-8-29(20-32)35-14-5-17-41-26-35)24-39(23-37)33-12-3-9-30(21-33)36-15-6-18-42-27-36;1-3-2/h1-27H;3H2,1-2H3 |
| InChIKey | RZXCMYGNNQZYHQ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |