About ethylphosphane;3-(3-methylphenyl)pyridine
ethylphosphane;3-(3-methylphenyl)pyridine (PubChem CID 144632052) has the molecular formula C14H18NP
and a molecular weight of 231.28 g/mol. Its IUPAC name is ethylphosphane;3-(3-methylphenyl)pyridine.
Molecular Properties
| Compound Name | ethylphosphane;3-(3-methylphenyl)pyridine |
| PubChem CID | 144632052 |
| Molecular Formula | C14H18NP |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | ethylphosphane;3-(3-methylphenyl)pyridine |
| SMILES | CCP.Cc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C12H11N.C2H7P/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;1-2-3/h2-9H,1H3;2-3H2,1H3 |
| InChIKey | LSXFCESEXBVSLN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethylphosphane;3-(3-methylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylphosphane;3-(3-methylphenyl)pyridine?
The IUPAC name of ethylphosphane;3-(3-methylphenyl)pyridine (CID 144632052) is ethylphosphane;3-(3-methylphenyl)pyridine.
What is the SMILES notation for ethylphosphane;3-(3-methylphenyl)pyridine?
The canonical SMILES for ethylphosphane;3-(3-methylphenyl)pyridine is CCP.Cc1cccc(-c2cccnc2)c1.
What is the InChIKey of ethylphosphane;3-(3-methylphenyl)pyridine?
The InChIKey is LSXFCESEXBVSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C2H7P/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;1-2-3/h2-9H,1H3;2-3H2,1H3.
What are the key properties of ethylphosphane;3-(3-methylphenyl)pyridine?
ethylphosphane;3-(3-methylphenyl)pyridine has a molecular weight of 231.28 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylphosphane;3-(3-methylphenyl)pyridine is sourced from PubChem (CID 144632052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).