About methylidenephosphane;3-(3-methylphenyl)pyridine
methylidenephosphane;3-(3-methylphenyl)pyridine (PubChem CID 144875841) has the molecular formula C13H14NP
and a molecular weight of 215.24 g/mol. Its IUPAC name is methylidenephosphane;3-(3-methylphenyl)pyridine.
Molecular Properties
| Compound Name | methylidenephosphane;3-(3-methylphenyl)pyridine |
| PubChem CID | 144875841 |
| Molecular Formula | C13H14NP |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | methylidenephosphane;3-(3-methylphenyl)pyridine |
| SMILES | Cc1cccc(-c2cccnc2)c1.[H]P=C |
| InChI | InChI=1S/C12H11N.CH3P/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;1-2/h2-9H,1H3;2H,1H2 |
| InChIKey | VJJKLBNLMGPYCX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylidenephosphane;3-(3-methylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidenephosphane;3-(3-methylphenyl)pyridine?
The IUPAC name of methylidenephosphane;3-(3-methylphenyl)pyridine (CID 144875841) is methylidenephosphane;3-(3-methylphenyl)pyridine.
What is the SMILES notation for methylidenephosphane;3-(3-methylphenyl)pyridine?
The canonical SMILES for methylidenephosphane;3-(3-methylphenyl)pyridine is Cc1cccc(-c2cccnc2)c1.[H]P=C.
What is the InChIKey of methylidenephosphane;3-(3-methylphenyl)pyridine?
The InChIKey is VJJKLBNLMGPYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.CH3P/c1-10-4-2-5-11(8-10)12-6-3-7-13-9-12;1-2/h2-9H,1H3;2H,1H2.
What are the key properties of methylidenephosphane;3-(3-methylphenyl)pyridine?
methylidenephosphane;3-(3-methylphenyl)pyridine has a molecular weight of 215.24 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylidenephosphane;3-(3-methylphenyl)pyridine is sourced from PubChem (CID 144875841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).