C15H12N2O — CID 44546226
5-(3-methylphenyl)-3-pyridin-3-yl-1,2-oxazole (PubChem CID 44546226) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(3-methylphenyl)-3-pyridin-3-yl-1,2-oxazole.
| Compound Name | 5-(3-methylphenyl)-3-pyridin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 44546226 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-(3-methylphenyl)-3-pyridin-3-yl-1,2-oxazole |
| SMILES | Cc1cccc(-c2cc(-c3cccnc3)no2)c1 |
| InChI | InChI=1S/C15H12N2O/c1-11-4-2-5-12(8-11)15-9-14(17-18-15)13-6-3-7-16-10-13/h2-10H,1H3 |
| InChIKey | IYZYORWOMUSSAL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |