C21H18N2OSi — CID 10593425
methyl-diphenyl-(3-pyridin-3-yl-1,2-oxazol-5-yl)silane (PubChem CID 10593425) has the molecular formula C21H18N2OSi and a molecular weight of 342.47 g/mol. Its IUPAC name is methyl-diphenyl-(3-pyridin-3-yl-1,2-oxazol-5-yl)silane.
| Compound Name | methyl-diphenyl-(3-pyridin-3-yl-1,2-oxazol-5-yl)silane |
|---|---|
| PubChem CID | 10593425 |
| Molecular Formula | C21H18N2OSi |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl-diphenyl-(3-pyridin-3-yl-1,2-oxazol-5-yl)silane |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)c1cc(-c2cccnc2)no1 |
| InChI | InChI=1S/C21H18N2OSi/c1-25(18-10-4-2-5-11-18,19-12-6-3-7-13-19)21-15-20(23-24-21)17-9-8-14-22-16-17/h2-16H,1H3 |
| InChIKey | JQYVYOOFSJEWNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|